Introduction：Basic information about CAS 1779-10-8|4,7-Dibromo-3-hydroxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,7-Dibromo-3-hydroxy-2-naphthoic acid |
|---|
| CAS Number | 1779-10-8 | Molecular Weight | 345.971 |
|---|
| Density | 2.1±0.1 g/cm3 | Boiling Point | 427.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H6Br2O3 | Melting Point | 251-255 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 212.4±28.7 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4,7-dibromo-3-hydroxynaphthalene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.1±0.1 g/cm3 |
|---|
| Boiling Point | 427.6±45.0 °C at 760 mmHg |
|---|
| Melting Point | 251-255 °C(lit.) |
|---|
| Molecular Formula | C11H6Br2O3 |
|---|
| Molecular Weight | 345.971 |
|---|
| Flash Point | 212.4±28.7 °C |
|---|
| Exact Mass | 343.868347 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 5.10 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.754 |
|---|
| InChIKey | WNMKUIQCIRAXBN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2cc(Br)ccc2c(Br)c1O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1,6-Dibromo-2-naphthol-3-carboxylic Acid |
| MFCD00046367 |
| 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid |
| 1,6-dibromo-2-hydroxy-3-naphthoic acid |
| 2-Naphthalenecarboxylic acid, 4,7-dibromo-3-hydroxy- |
| 2-Naphthoic acid,7-dibromo-3-hydroxy |
| 4,7-Dibromo-3-hydroxy-2-naphthoic acid |
| 2-Naphthalenecarboxylic acid,7-dibromo-3-hydroxy |
| EINECS 217-214-7 |
| 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylicacid |
