Introduction:Basic information about CAS 62942-43-2|Formylmethyltriphenylphosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Formylmethyltriphenylphosphonium chloride |
|---|
| CAS Number | 62942-43-2 | Molecular Weight | 340.783 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H18ClOP | Melting Point | 209-212 °C (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | (formylmethyl)triphenylphosphonium chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 209-212 °C (dec.)(lit.) |
|---|
| Molecular Formula | C20H18ClOP |
|---|
| Molecular Weight | 340.783 |
|---|
| Exact Mass | 340.078369 |
|---|
| PSA | 30.66000 |
|---|
| LogP | 0.18340 |
|---|
| InChIKey | RVEJRPJGKXTQIF-UHFFFAOYSA-M |
|---|
| SMILES | O=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22;R41 |
|---|
| Safety Phrases | S26-S39 |
|---|
| RIDADR | 1759 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (2-Oxoethyl)(triphenyl)phosphonium chloride |
| 2-oxoethyl(triphenyl)phosphanium,chloride |
| EINECS 263-767-2 |
| Formylmethyltriphenylphosphonium chloride |
| Phosphonium, (2-oxoethyl)triphenyl-, chloride (1:1) |
| Phosphonium, (2-oxoethyl)triphenyl-, chloride |
| MFCD00012003 |