CAS 81475-22-1|4-tert-Butylcalix[5]arene
Introduction：Basic information about CAS 81475-22-1|4-tert-Butylcalix[5]arene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-Butylcalix[5]arene | ||
|---|---|---|---|
| CAS Number | 81475-22-1 | Molecular Weight | 811.141 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 792.3±60.0 °C at 760 mmHg |
| Molecular Formula | C55H70O5 | Melting Point | 310-312ºC(lit.) |
| MSDS | / | Flash Point | 270.6±27.5 °C |
Names
| Name | 4-tert-Butylcalix[5]arene |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 792.3±60.0 °C at 760 mmHg |
| Melting Point | 310-312ºC(lit.) |
| Molecular Formula | C55H70O5 |
| Molecular Weight | 811.141 |
| Flash Point | 270.6±27.5 °C |
| Exact Mass | 810.522339 |
| PSA | 101.15000 |
| LogP | 15.16 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | HTJNUHSOASZVHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
Safety Information
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
Synonyms
| para-tert-butylcalix[5]arene |
| 5,11,17,23,29-pentakis(1,1-dimethylethyl)-35,36,37,38,39-pentahydroxycalix[5]arene |
| p-t-butylcalix[5]arene |
| MFCD00210028 |
| Penta-tert-butyl(pentahydroxy)calix[5]arene |
| hexacyclo[25.3.1.1.1.1.1]pentatriaconta-1(31),3,5,7(35),9,11,13(34),15,17,19(33),21,23,25(32),27,29-pentadecaene-31,32,33,34,35-pentol, 5,11,17,23,29-pentakis(1,1-dimethylethyl)- |
| B2221 |
| Hexacyclo[25.3.1.1.1.1.1]pentatriaconta-1(31),3,5,7(35),9,11,13(34),15,17,19(33),21,23,25(32),27,29-pentadecaene-31,32,33,34,35-pentol, 5,11,17,23,29-pentakis(1,1-dimethylethy
 l)- |
| 5,11,17,23,29-Penta-tert-butylhexacyclo[25.3.1.1.1.1.1]pentatriaconta-1(31),3(35),4,6,9(34),10,12,15(33),16,18,21(32),22,24,27,29-pentadecaene-31,32,33,34,35-pentol |
| p-tert-butylcalix<5>arene |
| 5,11,17,23,29-Pentakis(2-methyl-2-propanyl)hexacyclo[25.3.1.1.1.1.1]pentatriaconta-1(31),3(35),4,6,9(34),10,12,15(33),16,18,21(32),22,24,27,29-pentadecaene-31,32,33,34,35-pent 
ol |
