Introduction：Basic information about CAS 375-72-4|Perfluorobutanesulfonyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Perfluorobutanesulfonyl fluoride |
|---|
| CAS Number | 375-72-4 | Molecular Weight | 302.091 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 64.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4F10O2S | Melting Point | -110°C |
|---|
| MSDS | ChineseUSA | Flash Point | -7.4±25.9 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | Nonafluorobutanesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 64.2±35.0 °C at 760 mmHg |
|---|
| Melting Point | -110°C |
|---|
| Molecular Formula | C4F10O2S |
|---|
| Molecular Weight | 302.091 |
|---|
| Flash Point | -7.4±25.9 °C |
|---|
| Exact Mass | 301.945923 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 6.13 |
|---|
| Vapour Pressure | 178.4±0.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.287 |
|---|
| InChIKey | LUYQYZLEHLTPBH-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US) |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45-S25 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2942000000 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride |
| 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulfonyl fluoride |
| perfluorobutanesulfonylfluoride |
| Perfluorobutanesulfonyl fluoride |
| Nonafluorobutanesulfonyl fluoride |
| Nonafluoro-1-butanesulfonyl Fluoride |
| EINECS 206-792-6 |
| 1-Butanesulfonyl fluoride, 1,1,2,2,3,3,4,4,4-nonafluoro- |
| Perfluoro-1-butanesulfonyl Fluoride |
| MFCD00007422 |
| perfluorobutylsulfonylfluoride/FC-4 |
| Perfluoro butane sulfonyl fluoride |
