Introduction:Basic information about CAS 15111-96-3|perillyl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perillyl acetate |
|---|
| CAS Number | 15111-96-3 | Molecular Weight | 194.27000 |
|---|
| Density | 0.967g/cm3 | Boiling Point | 258.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H18O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 98.9ºC |
|---|
Names
| Name | (4-prop-1-en-2-ylcyclohexen-1-yl)methyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.967g/cm3 |
|---|
| Boiling Point | 258.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H18O2 |
|---|
| Molecular Weight | 194.27000 |
|---|
| Flash Point | 98.9ºC |
|---|
| Exact Mass | 194.13100 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 2.85210 |
|---|
| Vapour Pressure | 0.0138mmHg at 25°C |
|---|
| Index of Refraction | 1.473 |
|---|
| InChIKey | WTXBCFKGCNWPLS-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C1CC=C(COC(C)=O)CC1 |
|---|
Safety Information
Customs
| HS Code | 2915390090 |
|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| Perilla acetate |
| acetic acid p-mentha-1,8-dien-7-yl ester |
| p-Mentha-1,8-dien-7-ol,acetate |
| Dihydrocuminyl acetate |
| Menthadien-7-carbinyl acetate |
| p-Mentha-1,8-dien-7-yl acetate |
| 1-Cyclohexene-1-methanol,4-(1-methylethenyl)-,acetate |
| EINECS 239-162-4 |
| perillyl acetate |
| 4-isopropenylcyclohex-1-enylmethyl acetate |
| 1,8-P-Menthadien-7-yl acetate |
| (+-)-7-acetoxy-p-mentha-1,8-diene |
| FEMA No. 3561 |
| (+-)-7-Acetoxy-p-mentha-1,8-dien |
| Essigsaeure-p-mentha-1,8-dien-7-ylester |