Introduction：Basic information about CAS 52236-30-3|DADK, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DADK |
|---|
| CAS Number | 52236-30-3 | Molecular Weight | 169.181 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H11N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-tert-butyl-2H-1,2,4-triazine-3,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C7H11N3O2 |
|---|
| Molecular Weight | 169.181 |
|---|
| Exact Mass | 169.085129 |
|---|
| PSA | 78.61000 |
|---|
| LogP | 0.92 |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | ZARIFGFXSIZTAK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1n[nH]c(=O)[nH]c1=O |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 6-(2-Methyl-2-propanyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| 6-(2-Méthyl-2-propanyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| 6-(tert-butyl)-2H,4H-1,2,4-triazine-3,5-dione |
| 1,2,4-Triazine-3,5(2H,4H)-dione,6-(1,1-dimethylethyl) |
| Metribuzin deaminated diketo metabolite |
| 6-(2-Methyl-2-propanyl)-1,2,4-triazin-3,5(2H,4H)-dion |
| Metribuzin DADK |
| 1,2,4-Triazine-3,5(2H,4H)-dione, 6-(1,1-dimethylethyl)- |
| DADK |
| 6-tert-Butyl-1,2,4-triazine-3,5(2H,4H)-dione |
| Sencor deaminated diketo metabolite |
| 6-tert-Butyl-3,5-dihydroxy-1,2,4-triazine |
