CAS 60705-62-6|4-tert-Butylcalix[4]arene
Introduction:Basic information about CAS 60705-62-6|4-tert-Butylcalix[4]arene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-Butylcalix[4]arene | ||
|---|---|---|---|
| CAS Number | 60705-62-6 | Molecular Weight | 648.913 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 683.1±55.0 °C at 760 mmHg |
| Molecular Formula | C44H56O4 | Melting Point | ≥300 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 252.6±26.1 °C |
Names
| Name | 4-tert-Butylcalix[4]arene |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 683.1±55.0 °C at 760 mmHg |
| Melting Point | ≥300 °C(lit.) |
| Molecular Formula | C44H56O4 |
| Molecular Weight | 648.913 |
| Flash Point | 252.6±26.1 °C |
| Exact Mass | 648.417847 |
| PSA | 80.92000 |
| LogP | 12.13 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | NVKLTRSBZLYZHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
Articles2
More ArticlesAldrichimica Acta 28 , 3, (1995) | |
| Gutsche, C.D. Calixarenes Cambridge, UK , (1989) |
Synonyms
| Pentacyclo[19.3.1.1(3,7).1(9,13).1(15,19)]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol, 5,11,17,23-tetrakis(1,1-dimethylethyl) |
| p-tert-Butylcalix[4]arene |
| 5,11,17,23-tetra-tert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
| Pentacyclo[19.3.1.1.1.1]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol, 5,11,17,23-tetrakis(1,1-dimethylethyl)- |
| 5,11,17,23-Tetrakis(2-methyl-2-propanyl)pentacyclo[19.3.1.1.1.1]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
| 5,11,17,23-Tetratert-butylpentacyclo[19.3.1.1.1.1]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
| 5,11,17,23-Tetra-tert-butylpentacyclo[19.3.1.1.1.1]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
| 4-t-Butylcalix[4]arene |
| MFCD00066280 |
| 5,11,17,23-Tetratert-butylpentacyclo(19.3.1.1(3,7).1(9,13).1(15,19))octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
| 4-tert-Butylcalix[4]arene |
