Introduction:Basic information about CAS 624-10-2|Decanedioic acid,1,10-bis(2-ethoxyethyl) ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Decanedioic acid,1,10-bis(2-ethoxyethyl) ester |
|---|
| CAS Number | 624-10-2 | Molecular Weight | 346.45900 |
|---|
| Density | 1.003g/cm3 | Boiling Point | 407.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H34O6 | Melting Point | -1ºC |
|---|
| MSDS | / | Flash Point | 172.6ºC |
|---|
Names
| Name | bis(2-ethoxyethyl) decanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.003g/cm3 |
|---|
| Boiling Point | 407.1ºC at 760 mmHg |
|---|
| Melting Point | -1ºC |
|---|
| Molecular Formula | C18H34O6 |
|---|
| Molecular Weight | 346.45900 |
|---|
| Flash Point | 172.6ºC |
|---|
| Exact Mass | 346.23600 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 3.26660 |
|---|
| Index of Refraction | 1.444-1.446 |
|---|
| InChIKey | UVRXDBUBNLXONB-UHFFFAOYSA-N |
|---|
| SMILES | CCOCCOC(=O)CCCCCCCCC(=O)OCCOCC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36 |
|---|
| Safety Phrases | 39-26 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| AC1L2KVP |
| Sebacic acid,bis(2-ethoxyethyl) ester |
| EINECS 210-829-1 |
| Bis(2-ethoxyethyl) sebacate |
| |A-ethoxyethyl sebacate |
| MFCD00041927 |
| Bis-(2-ethoxy-ethyl)-sebacat |
| Decanedioic acid,bis(2-ethoxyethyl) ester |
| Decandisaeure-bis-(2-aethoxy-aethylester) |
| AC1Q68B5 |