Introduction:Basic information about CAS 66472-86-4|3-Aminobenzeneboronic acid hemisulfate salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Aminobenzeneboronic acid hemisulfate salt |
|---|
| CAS Number | 66472-86-4 | Molecular Weight | 371.967 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 376ºC at 760 mmHg |
|---|
| Molecular Formula | C12H18B2N2O8S | Melting Point | 300ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 181.2ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-Aminobenzeneboronic acid hemisulfate salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 376ºC at 760 mmHg |
|---|
| Melting Point | 300ºC |
|---|
| Molecular Formula | C12H18B2N2O8S |
|---|
| Molecular Weight | 371.967 |
|---|
| Flash Point | 181.2ºC |
|---|
| Exact Mass | 372.096985 |
|---|
| PSA | 215.94000 |
|---|
| InChIKey | UKTAURVTSWDIQR-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(B(O)O)c1.Nc1cccc(B(O)O)c1.O=S(=O)(O)O |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29310095 |
|---|
Customs
Synonyms
| (3-aminophenyl)boronic acid,sulfuric acid |
| EINECS 266-376-5 |
| (3-Aminophenyl)boronic acid sulfate (2:1) |
| Boronic acid, B-(3-aminophenyl)-, sulfate (2:1) |
| MFCD00013111 |