Introduction：Basic information about CAS 6252-78-4|sodium 2-[3-(4-sulfonato-o-tolyliminio)-6-o-toluidino-3H-xanthen-9-yl]benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium 2-[3-(4-sulfonato-o-tolyliminio)-6-o-toluidino-3H-xanthen-9-yl]benzoate |
|---|
| CAS Number | 6252-78-4 | Molecular Weight | 612.62700 |
|---|
| Density | 1.505g/cm3 | Boiling Point | 507.2ºC at 760 mmHg |
|---|
| Molecular Formula | C34H25N2NaO6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.4ºC |
|---|
Names
| Name | sodium 2-[3-(4-sulfonato-o-tolyliminio)-6-o-toluidino-3H-xanthen-9-yl]benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.505g/cm3 |
|---|
| Boiling Point | 507.2ºC at 760 mmHg |
|---|
| Molecular Formula | C34H25N2NaO6S |
|---|
| Molecular Weight | 612.62700 |
|---|
| Flash Point | 225.4ºC |
|---|
| Exact Mass | 612.13300 |
|---|
| PSA | 144.85000 |
|---|
| LogP | 5.29940 |
|---|
| Index of Refraction | 1.827 |
|---|
| InChIKey | UFLQLEHQELUPJU-JZJYNLBNSA-N |
|---|
| SMILES | O=C1C(=c2c(=O)c3cccc4cccc2c43)Sc2ccccc21 |
|---|
Synonyms
| Acid Violet 9 (C.I.) |
| C.I. Acid Violet 9 |
| 2-(2-oxo-2H-acenaphth-1-ylidene)benzo[b]thiophene-3(2H)-one |
| (Acenaphthen-(1))-(thionaphthen-(2))-indigo |
| Einecs 228-378-4 |
| C.I.Vat Red 45 |
| 2-(1-Oxoacenaphthene-2-ylidene)benzo[b]thiophene-3(2H)-one |
| Vat Red 45 |
| 2-(2-Oxoacenaphthylen-1(2H)-ylidene)benzo[b]thiophen-3(2H)-one |
| 2-(2-oxo-acenaphthen-1-ylidene)-benzo[b]thiophen-3-one |
| 2-Thionaphthen-acenaphthylen-indigo |
| 2-(2-Oxo-acenaphthen-1-yliden)-benzo[b]thiophen-3-on |
| 1'-Acenaphthen-2-thianaphthenindigo |
