Introduction：Basic information about CAS 2379-77-3|Vat Red 32, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vat Red 32 |
|---|
| CAS Number | 2379-77-3 | Molecular Weight | 611.42900 |
|---|
| Density | 1.631 | Boiling Point | / |
|---|
| Molecular Formula | C36H16Cl2N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,9-Bis(4-chlorophenyl)anthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.631 |
|---|
| Molecular Formula | C36H16Cl2N2O4 |
|---|
| Molecular Weight | 611.42900 |
|---|
| Exact Mass | 610.04900 |
|---|
| PSA | 78.14000 |
|---|
| LogP | 7.24820 |
|---|
| Index of Refraction | 1.881 |
|---|
| InChIKey | ILYBWLBYEIZMCE-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1c1ccc(Cl)cc1)c64)C(=O)N(c1ccc(Cl)cc1)C5=O |
|---|
Synonyms
| Vat Red 32 |
| 2,9-Bis-(4-chlor-phenyl)-anthra[2,1,9-def,6,5,10-d'e'f']diisochinolin-1,3,8,10-tetraon |
| Indanthrene Red LLG |
| EINECS 219-166-2 |
| C.I. Vat Red 32 |
| 2,9-bis-(4-chloro-phenyl)-anthra[2,1,9-def,6,5,10-d'e'f']diisoquinoline-1,3,8,10-tetraone |
| 3,4,9,10-perylenetetracarboxylic acid N,N'-di(4-chlorophenyl)diimide |
| C.I. Pigment Red 189 |
| Brilliant Red LGG |
