Introduction：Basic information about CAS 24905-87-1|Ethanol, 2-(4-amino-3-nitroanilino)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanol, 2-(4-amino-3-nitroanilino)- |
|---|
| CAS Number | 24905-87-1 | Molecular Weight | 197.191 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 436.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H11N3O3 | Melting Point | 93-95ºC |
|---|
| MSDS | / | Flash Point | 217.9±25.9 °C |
|---|
Names
| Name | 2-(4-Amino-3-nitroanilino)ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 436.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 93-95ºC |
|---|
| Molecular Formula | C8H11N3O3 |
|---|
| Molecular Weight | 197.191 |
|---|
| Flash Point | 217.9±25.9 °C |
|---|
| Exact Mass | 197.080048 |
|---|
| PSA | 104.10000 |
|---|
| LogP | 0.60 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | DAGCJJZWDAVKRE-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(NCCO)cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2922199090 |
|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-[(4-Amino-3-nitrophenyl)amino]ethanol |
| Ethanol, 2-(4-amino-3-nitroanilino)- |
| EINECS 246-521-9 |
| 1-amino-4-(2'-hydroxyethyl)amino-2-nitrobenzene |
| 2-(4-Amino-3-nitro-anilino)-aethanol |
| MFCD00239473 |
| 2-((4-Amino-3-nitrophenyl)amino)ethanol |
| 2-nitro-4-(2'-hydroxyethylamino)aniline |
| Ethanol, 2-((4-amino-3-nitrophenyl)amino)- |
| Ethanol, 2-[(4-amino-3-nitrophenyl)amino]- |
| 2-(4-amino-3-nitro-anilino)-ethanol |
| 2-amino-5-[(2'-hydroxyethyl)-amino]-nitrobenzene |
| 1-amino-2-nitro-4-(2-hydroxyethyl)aminobenzene |
| HC Red no. 7 |
