Introduction：Basic information about CAS 69571-02-4|4,4'-diiodo-2,2'-dimethyl-1,1'-biphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-diiodo-2,2'-dimethyl-1,1'-biphenyl |
|---|
| CAS Number | 69571-02-4 | Molecular Weight | 434.05400 |
|---|
| Density | 1.875 | Boiling Point | 374.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12I2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 175.5ºC |
|---|
| Symbol |
GHS05, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.875 |
|---|
| Boiling Point | 374.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12I2 |
|---|
| Molecular Weight | 434.05400 |
|---|
| Flash Point | 175.5ºC |
|---|
| Exact Mass | 433.90300 |
|---|
| LogP | 5.17960 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | WHFMNDMHTIOIMS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(I)ccc1-c1ccc(I)cc1C |
|---|
Safety Information
| Symbol |
GHS05, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318-H410 |
|---|
| Precautionary Statements | P273-P280-P305 + P351 + P338-P501 |
|---|
| RIDADR | UN 3152PSN1 9 / PGII |
|---|
Synonyms
| 2,2'-dimethyl-4,4'-diiodobiphenyl |
| 4,4'-Diiodo-2,2'-dimethylbiphenyl |
| 4,4'-DIIODO-2,2'-DIMETHYLBIPHENYL |
| 4,4'-Diiodo-2,2'-dimethyl-1,1'-biphenyl |
