Introduction：Basic information about CAS 22110-53-8|1-Isocyanoadamantane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Isocyanoadamantane |
|---|
| CAS Number | 22110-53-8 | Molecular Weight | 161.243 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H15N | Melting Point | 175ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-isocyanoadamantane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 175ºC |
|---|
| Molecular Formula | C11H15N |
|---|
| Molecular Weight | 161.243 |
|---|
| Exact Mass | 161.120453 |
|---|
| LogP | 2.10520 |
|---|
| InChIKey | RPRJRJNIFAYHRF-UHFFFAOYSA-N |
|---|
| SMILES | [C-]#[N+]C12CC3CC(CC(C3)C1)C2 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 + H312 + H332 |
|---|
| Precautionary Statements | P280 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-adamantylisonitrile |
| Adamantane, 1-isocyano- |
| 1-adamantanisocyanide |
| 1-Isocyano-adamantane |
| adamantan-1-isonitrile |
| 1-isocyanotricyclo[3.3.1.1]decane |
| tricyclo[3.3.1.1]dec-1-yl isocyanide |
| Tricyclo[3.3.1.1]decane, 1-isocyano- |
| 1-Adamantaneisocyanide |
| adamantyl-1-isocyanide |
| 1-Adamantyl isocyanide |
| 1-Isocyanoadamantane |
| 1-adamantanyl isocyanide |
| Adamantan-1-yl isocyanide |
| TOS-BB-0761 |
