Introduction：Basic information about CAS 69976-08-5|3-(8-chloroquinoline-4-yl)acrylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(8-chloroquinoline-4-yl)acrylic acid |
|---|
| CAS Number | 69976-08-5 | Molecular Weight | 233.65000 |
|---|
| Density | 1.421g/cm3 | Boiling Point | 438.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219ºC |
|---|
Names
| Name | 3-(8-chloroquinoline-4-yl)acrylic acid |
|---|
Chemical & Physical Properties
| Density | 1.421g/cm3 |
|---|
| Boiling Point | 438.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO2 |
|---|
| Molecular Weight | 233.65000 |
|---|
| Flash Point | 219ºC |
|---|
| Exact Mass | 233.02400 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 2.98600 |
|---|
| Index of Refraction | 1.714 |
|---|
| InChIKey | WGGJQKJWPLYDTQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C=Cc1ccnc2c(Cl)cccc12 |
|---|
