Introduction:Basic information about CAS 67570-38-1|2-[3,5-bis-(Trifluoromethyl)phenyl]propan-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[3,5-bis-(Trifluoromethyl)phenyl]propan-2-ol |
|---|
| CAS Number | 67570-38-1 | Molecular Weight | 272.18700 |
|---|
| Density | 1.333g/cm3 | Boiling Point | 184.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10F6O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 65.2ºC |
|---|
Names
| Name | 2-[3,5-Bis(trifluoromethyl)phenyl]propan-2-ol |
|---|
Chemical & Physical Properties
| Density | 1.333g/cm3 |
|---|
| Boiling Point | 184.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10F6O |
|---|
| Molecular Weight | 272.18700 |
|---|
| Flash Point | 65.2ºC |
|---|
| Exact Mass | 272.06400 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.95160 |
|---|
| Index of Refraction | 1.418 |
|---|
| InChIKey | CLPUBDXEFYRXMU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|---|