Introduction：Basic information about CAS 5288-22-2|8-FLUORO-2-METHYLQUINOLIN-4-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-FLUORO-2-METHYLQUINOLIN-4-OL |
|---|
| CAS Number | 5288-22-2 | Molecular Weight | 177.17500 |
|---|
| Density | 1.305 g/cm3 | Boiling Point | 316.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 145.3ºC |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 8-fluoro-2-methyl-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.305 g/cm3 |
|---|
| Boiling Point | 316.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO |
|---|
| Molecular Weight | 177.17500 |
|---|
| Flash Point | 145.3ºC |
|---|
| Exact Mass | 177.05900 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 2.38790 |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | LLUXFHIYAWGJGO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2cccc(F)c2[nH]1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 8-fluoro-2-methylquinolin-4-ol |
| 8-Fluor-4-hydroxy-2-methylchinolin |
| 4-Hydroxy-8-fluor-2-methyl-chinolin |
| F2156-0045 |
| 8-Fluoro-4-hydroxyquinaldine |
| 8-Fluoro-4-hydroxy-2-methylquinoline |
| 8-FLUORO-2-METHYL-4-QUINOLINOL |
