Introduction:Basic information about CAS 228728-23-2|4-hydroxy-6-iodoquinoline-3-carboxylic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-hydroxy-6-iodoquinoline-3-carboxylic acid ethyl ester |
|---|
| CAS Number | 228728-23-2 | Molecular Weight | 343.11700 |
|---|
| Density | 1.748g/cm3 | Boiling Point | 413.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H10INO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.6ºC |
|---|
Names
| Name | 4-hydroxy-6-iodoquinoline-3-carboxylic acid ethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.748g/cm3 |
|---|
| Boiling Point | 413.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H10INO3 |
|---|
| Molecular Weight | 343.11700 |
|---|
| Flash Point | 203.6ºC |
|---|
| Exact Mass | 342.97100 |
|---|
| PSA | 59.42000 |
|---|
| LogP | 2.72170 |
|---|
| Vapour Pressure | 4.92E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | NPZATCMFCFASBE-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c[nH]c2ccc(I)cc2c1=O |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| BUTTPARK 89 1-91 |
| ethyl 6-iodo-4-oxo-1H-quinoline-3-carboxylate |
| ethyl 6-iodo-4-oxo-1,4-dihydroquinoline-3-carboxylate |
| ethyl 6-iodo-4-oxo-1.4-dihydro-3-quinolinecarboxylate |
| 6-iodo-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester |
| ethyl 1,4-dihydro-6-iodo-4-oxoquinoline-3-carboxylate |
| 1,4-dihydro-6-iodo-4-oxoquinoline-3-carboxylic acid ethyl ester |