Introduction：Basic information about CAS 69976-11-0|3-(8-chloroquinoline-4-yl)acrylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(8-chloroquinoline-4-yl)acrylic acid methyl ester |
|---|
| CAS Number | 69976-11-0 | Molecular Weight | 247.67700 |
|---|
| Density | 1.305g/cm3 | Boiling Point | 402ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.9ºC |
|---|
Names
| Name | 3-(8-chloroquinoline-4-yl)acrylic acid methyl ester |
|---|
Chemical & Physical Properties
| Density | 1.305g/cm3 |
|---|
| Boiling Point | 402ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClNO2 |
|---|
| Molecular Weight | 247.67700 |
|---|
| Flash Point | 196.9ºC |
|---|
| Exact Mass | 247.04000 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 3.07440 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | XNOOOUZGOPQXON-AATRIKPKSA-N |
|---|
| SMILES | COC(=O)C=Cc1ccnc2c(Cl)cccc12 |
|---|
