Introduction：Basic information about CAS 10169-55-8|4-Acetyldiphenyl Sulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Acetyldiphenyl Sulfide |
|---|
| CAS Number | 10169-55-8 | Molecular Weight | 228.309 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12OS | Melting Point | 67-68°C |
|---|
| MSDS | / | Flash Point | 215.0±8.9 °C |
|---|
Names
| Name | 4-Acetyldiphenyl Sulfide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 389.6±25.0 °C at 760 mmHg |
|---|
| Melting Point | 67-68°C |
|---|
| Molecular Formula | C14H12OS |
|---|
| Molecular Weight | 228.309 |
|---|
| Flash Point | 215.0±8.9 °C |
|---|
| Exact Mass | 228.060883 |
|---|
| PSA | 42.37000 |
|---|
| LogP | 4.26 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | XUDYHODVSUXRPW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(Sc2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S23-S36/37/39 |
|---|
Synonyms
| Ethanone, 1-[4-(phenylthio)phenyl]- |
| 1-[4-(Phenylsulfanyl)phenyl]ethanone |
| EINECS 233-443-5 |
| 1-(4-phenylsulfanylphenyl)ethanone |
| 1-(4-(Phenylthio)phenyl)ethan-1-one |
| 1-(4-(Phenylthio)phenyl)ethanone |
| 4-(Phenylthio)acetophenone |
| MFCD00026227 |
