Introduction：Basic information about CAS 72542-80-4|5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|
| CAS Number | 72542-80-4 | Molecular Weight | 208.14600 |
|---|
| Density | 1.479g/cm3 | Boiling Point | 392.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5FN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191ºC |
|---|
Names
| Name | 5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.479g/cm3 |
|---|
| Boiling Point | 392.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5FN2O3 |
|---|
| Molecular Weight | 208.14600 |
|---|
| Flash Point | 191ºC |
|---|
| Exact Mass | 208.02800 |
|---|
| PSA | 76.22000 |
|---|
| LogP | 1.57390 |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | KWUXWIDZUGRNQK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1noc(-c2ccc(F)cc2)n1 |
|---|
