Introduction:Basic information about CAS 149017-66-3|PPADS, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | PPADS |
|---|
| CAS Number | 149017-66-3 | Molecular Weight | 599.30500 |
|---|
| Density | 1.94g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H10N3Na4O12PS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[(2E)-2-[4-formyl-6-methyl-5-oxo-3-(phosphonooxymethyl)pyridin-2-ylidene]hydrazinyl]benzene-1,3-disulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.94g/cm3 |
|---|
| Molecular Formula | C14H10N3Na4O12PS2 |
|---|
| Molecular Weight | 599.30500 |
|---|
| Exact Mass | 598.90300 |
|---|
| PSA | 288.30000 |
|---|
| LogP | 3.77900 |
|---|
| Index of Refraction | 1.729 |
|---|
| InChIKey | PNFZSRRRZNXSMF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(N=Nc2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c(COP(=O)(O)O)c(C=O)c1O |
|---|
Safety Information