Introduction:Basic information about CAS 81447-80-5|Diprafenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diprafenone |
|---|
| CAS Number | 81447-80-5 | Molecular Weight | 369.49700 |
|---|
| Density | 1.072g/cm3 | Boiling Point | 530.6ºC at 760 mmHg |
|---|
| Molecular Formula | C23H31NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 274.7ºC |
|---|
Names
| Name | 1-[2-[2-hydroxy-3-(2-methylbutan-2-ylamino)propoxy]phenyl]-3-phenylpropan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.072g/cm3 |
|---|
| Boiling Point | 530.6ºC at 760 mmHg |
|---|
| Molecular Formula | C23H31NO3 |
|---|
| Molecular Weight | 369.49700 |
|---|
| Flash Point | 274.7ºC |
|---|
| Exact Mass | 369.23000 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 4.41090 |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | VDKMYSMWQCFYBQ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)NCC(O)COc1ccccc1C(=O)CCc1ccccc1 |
|---|
Synonyms
| Diprafenonum |
| Diprafenona |
| Diprafenone |