Introduction：Basic information about CAS 32974-36-0|pentafluorobenzyl p-toluenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pentafluorobenzyl p-toluenesulfonate |
|---|
| CAS Number | 32974-36-0 | Molecular Weight | 352.27600 |
|---|
| Density | 1.495g/cm3 | Boiling Point | 395.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H9F5O3S | Melting Point | 78°C |
|---|
| MSDS | / | Flash Point | 192.9ºC |
|---|
Names
| Name | (2,3,4,5,6-pentafluorophenyl)methyl 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.495g/cm3 |
|---|
| Boiling Point | 395.4ºC at 760mmHg |
|---|
| Melting Point | 78°C |
|---|
| Molecular Formula | C14H9F5O3S |
|---|
| Molecular Weight | 352.27600 |
|---|
| Flash Point | 192.9ºC |
|---|
| Exact Mass | 352.01900 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 4.67680 |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | BKNSDBYJUGNUDL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2906299090 |
|---|
Customs
| HS Code | 2906299090 |
|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Pentafluorobenzyl tosylate |
| Pentafluorobenzyl toluene-4-sulphonate |
| 2,3,4,5,6-Pentafluorbenzyl-toluol-p-sulfonat |
| PFB - Tosylate |
| Pentafluorobenzyl 4-methylbenzenesulphonate |
| MFCD06248628 |
| PFB-Tosylate |
| PC5557E |
| Pentafluorobenzyl p-Toluenesulfonate |
