Introduction：Basic information about CAS 52240-20-7|3-(p-chlorobenzoyl)-2-methylpropionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(p-chlorobenzoyl)-2-methylpropionic acid |
|---|
| CAS Number | 52240-20-7 | Molecular Weight | 226.65600 |
|---|
| Density | / | Boiling Point | 407.6ºC at 760mmHg |
|---|
| Molecular Formula | C11H11ClO3 | Melting Point | 137-139ºC |
|---|
| MSDS | USA | Flash Point | 200.3ºC |
|---|
Names
| Name | 3-(p-chlorobenzoyl)-2-methylpropionic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 407.6ºC at 760mmHg |
|---|
| Melting Point | 137-139ºC |
|---|
| Molecular Formula | C11H11ClO3 |
|---|
| Molecular Weight | 226.65600 |
|---|
| Flash Point | 200.3ºC |
|---|
| Exact Mass | 226.04000 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.63350 |
|---|
| InChIKey | GSFUBCGLEXRAJW-UHFFFAOYSA-N |
|---|
| SMILES | CC(CC(=O)c1ccc(Cl)cc1)C(=O)O |
|---|
Safety Information
| Safety Phrases | 24/25 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
