Introduction：Basic information about CAS 2919-20-2|1,1-DI(P-TOLYL)ETHYLENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1-DI(P-TOLYL)ETHYLENE |
|---|
| CAS Number | 2919-20-2 | Molecular Weight | 208.29800 |
|---|
| Density | 0.971g/cm3 | Boiling Point | 316.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.5ºC |
|---|
Names
| Name | 1-methyl-4-[1-(4-methylphenyl)ethenyl]benzene |
|---|
Chemical & Physical Properties
| Density | 0.971g/cm3 |
|---|
| Boiling Point | 316.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16 |
|---|
| Molecular Weight | 208.29800 |
|---|
| Flash Point | 150.5ºC |
|---|
| Exact Mass | 208.12500 |
|---|
| LogP | 4.36490 |
|---|
| Vapour Pressure | 0.000778mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | HEDMCKGHZIRQLS-UHFFFAOYSA-N |
|---|
| SMILES | C=C(c1ccc(C)cc1)c1ccc(C)cc1 |
|---|
Safety Information
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
