Introduction：Basic information about CAS 23153-09-5|4-(Methylsulfanyl)-2-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Methylsulfanyl)-2-nitroaniline |
|---|
| CAS Number | 23153-09-5 | Molecular Weight | 184.216 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 343.4±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.5±23.7 °C |
|---|
Names
| Name | 4-methylsulfanyl-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 343.4±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O2S |
|---|
| Molecular Weight | 184.216 |
|---|
| Flash Point | 161.5±23.7 °C |
|---|
| Exact Mass | 184.030655 |
|---|
| PSA | 97.14000 |
|---|
| LogP | 2.42 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | LWFOZCFJVOGQAM-UHFFFAOYSA-N |
|---|
| SMILES | CSc1ccc(N)c([N+](=O)[O-])c1 |
|---|
Synonyms
| AC-2770 |
| 1-amino-4-methylthio-2-nitrobenzene |
| 4-methylthio-2-nitroaniline |
| 4-(Methylsulfanyl)-2-nitroaniline |
| 2-nitro-4-methylthioaniline |
| 4-methylmercapto-2-nitroaniline |
| Benzenamine, 4-(methylthio)-2-nitro- |
