Introduction：Basic information about CAS 15386-80-8|2-Cyano-N-(3,4-dichlorophenyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Cyano-N-(3,4-dichlorophenyl)acetamide |
|---|
| CAS Number | 15386-80-8 | Molecular Weight | 229.063 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 449.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6Cl2N2O | Melting Point | 164-166ºC |
|---|
| MSDS | / | Flash Point | 225.4±28.7 °C |
|---|
Names
| Name | 2-Cyano-N-(3,4-dichlorophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 449.0±45.0 °C at 760 mmHg |
|---|
| Melting Point | 164-166ºC |
|---|
| Molecular Formula | C9H6Cl2N2O |
|---|
| Molecular Weight | 229.063 |
|---|
| Flash Point | 225.4±28.7 °C |
|---|
| Exact Mass | 227.985718 |
|---|
| PSA | 52.89000 |
|---|
| LogP | 2.12 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | HXXDPDIVNQZPCJ-UHFFFAOYSA-N |
|---|
| SMILES | N#CCC(=O)Nc1ccc(Cl)c(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Acetamide, 2-cyano-N-(3,4-dichlorophenyl)- |
| Acetamide,2-cyano-N-(3,4-dichlorophenyl) |
| N-(3,4-dichlorophenyl)-2-cyanoacetamide |
| N-cyanoacetyl-3,4-dichloroaniline |
| 2-Cyano-N-(3,4-dichlorophenyl)acetamide |
| cyanodichlorophenylacetamide |
| 2-Cyano-N-(3,4-dichlorophenyl)-acetamide |
| cyanoacetic acid 3',4'-dichloroanilide |
