Introduction：Basic information about CAS 100665-41-6|Ganoderenic acid B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ganoderenic acid B |
|---|
| CAS Number | 100665-41-6 | Molecular Weight | 514.650 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 702.7±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H42O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 392.8±29.4 °C |
|---|
Names
| Name | ganoderenic acid B |
|---|
| Synonym | More Synonyms |
|---|
Ganoderenic acid B BiologicalActivity
| Description | Ganoderenic acid B is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid B exhibits potent reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to Doxorubicin[1]. |
|---|
| Related Catalog | Research Areas >>CancerSignaling Pathways >>Others >>Others |
|---|
| References | [1]. Liu DL, et al. Ganoderma lucidum derived ganoderenic acid B reverses ABCB1-mediated multidrug resistance in HepG2/ADM cells. Int J Oncol. 2015 May;46(5):2029-38. |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 702.7±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H42O7 |
|---|
| Molecular Weight | 514.650 |
|---|
| Flash Point | 392.8±29.4 °C |
|---|
| Exact Mass | 514.293030 |
|---|
| PSA | 128.97000 |
|---|
| LogP | 2.39 |
|---|
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | QECQJYAIIIIKJB-QQPHKSTLSA-N |
|---|
| SMILES | CC(=CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O |
|---|
Synonyms
| Ganoderenic acid B |
| Lanosta-8,20(22)-dien-26-oic acid, 3,7-dihydroxy-11,15,23-trioxo-, (3β,5ξ,7β)- |
| (3β,5ξ,7β)-3,7-Dihydroxy-11,15,23-trioxolanosta-8,20(22)-dien-26-oic acid |
