Introduction:Basic information about CAS 179552-74-0|N-(3-chloro-4-fluorophenyl)-7-Methoxy-6-nitroquinazolin-4-aMine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(3-chloro-4-fluorophenyl)-7-Methoxy-6-nitroquinazolin-4-aMine |
|---|
| CAS Number | 179552-74-0 | Molecular Weight | 348.716 |
|---|
| Density | 1.5±0.0 g/cm3 | Boiling Point | 515.5±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10ClFN4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 265.6±0.0 °C |
|---|
Names
| Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.0 g/cm3 |
|---|
| Boiling Point | 515.5±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10ClFN4O3 |
|---|
| Molecular Weight | 348.716 |
|---|
| Flash Point | 265.6±0.0 °C |
|---|
| Exact Mass | 348.042542 |
|---|
| PSA | 92.86000 |
|---|
| LogP | 4.10 |
|---|
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | VKEKKVCWODTGAP-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1[N+](=O)[O-] |
|---|
Synonyms
| 4-(3-chloro-4-fluoroanilino)-7-methoxy-6-nitroquinazoline |
| 3-Chloro4-fluoro-phenyl-(7-methoxy-6-nitro-quinazoline-4-yl)-amine |
| (3-chloro-4-fluoro-phenyl)-(7-methoxy-6-nitro-quinazolin-4-yl)-amine |
| 4-Quinazolinamine, N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitro- |
| N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-nitro-4-quinazolinamine |
| 4-(3-chloro-4-fluorophenylamino)-6-nitro-7-methoxyquinazoline |