Introduction：Basic information about CAS 486422-16-6|1-((4-broMo-2-fluorophenyl)sulfonyl)-4-Methylpiperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-((4-broMo-2-fluorophenyl)sulfonyl)-4-Methylpiperazine |
|---|
| CAS Number | 486422-16-6 | Molecular Weight | 337.208 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 401.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14BrFN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.4±31.5 °C |
|---|
Names
| Name | 1-[(4-bromo-2-fluorophenyl)sulfonyl]-4-methylpiperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 401.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14BrFN2O2S |
|---|
| Molecular Weight | 337.208 |
|---|
| Flash Point | 196.4±31.5 °C |
|---|
| Exact Mass | 335.994324 |
|---|
| PSA | 49.00000 |
|---|
| LogP | 2.33 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | FVACKFHRBNHCAP-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Br)cc2F)CC1 |
|---|
Synonyms
| 1-[(4-Bromo-2-fluorophenyl)sulfonyl]-4-methylpiperazine |
| Piperazine, 1-[(4-bromo-2-fluorophenyl)sulfonyl]-4-methyl- |
| 1-((4-bromo-2-fluorophenyl)sulfonyl)-4-methylpiperazine |
| 1-[(4-bromo-2-fluorophenyl)sulphonyl]-4-methylpiperazine |
