Introduction:Basic information about CAS 502964-52-5|Grela catalyst, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Grela catalyst |
|---|
| CAS Number | 502964-52-5 | Molecular Weight | 671.620 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C31H38Cl2N3O3Ru | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | RuCl2(=CH(2-iPrO-5-NO2Ph))(ImH2Mes) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C31H38Cl2N3O3Ru |
|---|
| Molecular Weight | 671.620 |
|---|
| Exact Mass | 671.125610 |
|---|
| PSA | 61.53000 |
|---|
| LogP | 9.23020 |
|---|
| Appearance of Characters | Powder | green |
|---|
| InChIKey | RQQSRSPQJIAORC-UHFFFAOYSA-L |
|---|
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=[Ru](Cl)(Cl)=Cc2cc([N+](=O)[O-])ccc2OC(C)C)c(C)c1 |
|---|
Synonyms
| Ruthenium, [1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[[2-(1-methylethoxy-κO)-5-n |
| Grela catalyst |
| Dichloro(1,3-dimesityl-2-imidazolidinylidene)(2-isopropoxy-5-nitrobenzylidene)ruthenium |
| Ruthenium, [1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[[2-(1-methylethoxy)-5-nitrophenyl]methylene]- |
| Grela–Grubbs–Hoveyda catalyst |
| nitro-Grela catalyst |