Introduction:Basic information about CAS 17103-52-5|sulfamethoxazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sulfamethoxazole |
|---|
| CAS Number | 17103-52-5 | Molecular Weight | 253.27800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H11N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | sulfamethoxazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H11N3O3S |
|---|
| Molecular Weight | 253.27800 |
|---|
| Exact Mass | 253.05200 |
|---|
| PSA | 106.60000 |
|---|
| LogP | 3.10100 |
|---|
| InChIKey | KBLGZYOVYFTAOB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)on1 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-amino-N-(3-methyl-isoxazol-5-yl)-benzenesulfonamide |
| Sulfanilsaeure-(3-methyl-isoxazol-5-ylamid) |
| 5-Sulfanilamido-3-methylisoxazol |
| Sulfamethoxazole EP Impurity F |