Introduction：Basic information about CAS 4190-83-4|1,4-Bis((p-chlorophenoxy)acetyl)piperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Bis((p-chlorophenoxy)acetyl)piperazine |
|---|
| CAS Number | 4190-83-4 | Molecular Weight | 423.290 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 647.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H20Cl2N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 345.6±31.5 °C |
|---|
Names
| Name | 1,4-bis-[(4-chloro-phenoxy)-acetyl]-piperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 647.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H20Cl2N2O4 |
|---|
| Molecular Weight | 423.290 |
|---|
| Flash Point | 345.6±31.5 °C |
|---|
| Exact Mass | 422.080017 |
|---|
| PSA | 59.08000 |
|---|
| LogP | 3.09 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | AHMFDKPGQGSCJM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(COc1ccc(Cl)cc1)N1CCN(C(=O)COc2ccc(Cl)cc2)CC1 |
|---|
Synonyms
| 2-(4-Chloro-phenoxy)-1-{4-[2-(4-chloro-phenoxy)-acetyl]-piperazin-1-yl}-ethanone |
| Piperazine, 1,4-bis((p-chlorophenoxy)acetyl)- |
| 1,4-Bis((p-chlorophenoxy)acetyl)piperazine |
| 1,4-Bis-(4-chlor-phenoxyacetyl)-piperazin |
| Ethanone, 1,1'-(1,4-piperazinediyl)bis[2-(4-chlorophenoxy)- |
| 1,1'-(1,4-Piperazinediyl)bis[2-(4-chlorophenoxy)ethanone] |
