Introduction：Basic information about CAS 69536-83-0|N-acetylphenylalanylarginine ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-acetylphenylalanylarginine ethyl ester |
|---|
| CAS Number | 69536-83-0 | Molecular Weight | 391.465 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C19H29N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-acetylphenylalanylarginine ethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Molecular Formula | C19H29N5O4 |
|---|
| Molecular Weight | 391.465 |
|---|
| Exact Mass | 391.221954 |
|---|
| LogP | 1.20 |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | OYCLWYIGLJFSMM-HOTGVXAUSA-N |
|---|
| SMILES | CCOC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccccc1)NC(C)=O |
|---|
Synonyms
| Ac-Phe-arg-oet |
| N-Acetylphenylalanylarginine ethyl ester |
| L-Ornithine, N-acetyl-L-phenylalanyl-N-(diaminomethylene)-, ethyl ester |
| AC1L4Y0S |
| Ethyl N-acetyl-L-phenylalanyl-N-(diaminomethylene)-L-ornithinate |
| Ethyl n-acetyl-l-phenylalanyl-n5-(diaminomethylidene)-l-ornithinate |
