Introduction：Basic information about CAS 1704095-44-2|(5-(N-cyclopentylsulfamoyl)-2-Methoxyphenyl)boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5-(N-cyclopentylsulfamoyl)-2-Methoxyphenyl)boronic acid |
|---|
| CAS Number | 1704095-44-2 | Molecular Weight | 299.151 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 532.7±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18BNO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.0±32.9 °C |
|---|
Names
| Name | [5-(Cyclopentylsulfamoyl)-2-methoxyphenyl]boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 532.7±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18BNO5S |
|---|
| Molecular Weight | 299.151 |
|---|
| Flash Point | 276.0±32.9 °C |
|---|
| Exact Mass | 299.099884 |
|---|
| LogP | 2.36 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | XJIYITKJDWOLOZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(=O)(=O)NC2CCCC2)cc1B(O)O |
|---|
Synonyms
| [5-(Cyclopentylsulfamoyl)-2-methoxyphenyl]boronic acid |
| Boronic acid, B-[5-[(cyclopentylamino)sulfonyl]-2-methoxyphenyl]- |
| (5-(N-cyclopentylsulfaMoyl)-2-Methoxyphenyl)boronic acid |
