Introduction：Basic information about CAS 742691-70-9|3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid |
|---|
| CAS Number | 742691-70-9 | Molecular Weight | 225.241 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 383.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.7±27.9 °C |
|---|
Names
| Name | (3R)-3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 383.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15NO4 |
|---|
| Molecular Weight | 225.241 |
|---|
| Flash Point | 185.7±27.9 °C |
|---|
| Exact Mass | 225.100113 |
|---|
| LogP | 0.65 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | XZFWLSJPXJTSMZ-MRVPVSSYSA-N |
|---|
| SMILES | COc1cccc(C(N)CC(=O)O)c1OC |
|---|
Synonyms
| Benzenepropanoic acid, β-amino-2,3-dimethoxy-, (βR)- |
| MFCD04113639 |
| (3R)-3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid |
| 3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid |
