Introduction：Basic information about CAS 1018833-44-7|Trempamotide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trempamotide |
|---|
| CAS Number | 1018833-44-7 | Molecular Weight | 1205.312 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1627.0±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C58H80N10O18 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 937.8±34.3 °C |
|---|
Names
| Name | Trempamotide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 1627.0±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C58H80N10O18 |
|---|
| Molecular Weight | 1205.312 |
|---|
| Flash Point | 937.8±34.3 °C |
|---|
| Exact Mass | 1204.565186 |
|---|
| LogP | 3.69 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | PLPWPYMSYPDVMQ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(=O)O)C(=O)NC(CC(C)C)C(=O)O)C(C)CC |
|---|
Synonyms
| L-Leucine, L-isoleucyl-L-tyrosyl-L-asparaginyl-L-α-glutamyl-L-tyrosyl-L-isoleucyl-L-tyrosyl-L-α-aspartyl- |
| I0D08512Q1 |
| L-Isoleucyltyrosyl-L-asparaginyl-L-α-glutamyl-L-tyrosyl-L-isoleucyl-L-tyrosyl-L-α-aspartyl-L-leucine |
| L-Isoleucyl-L-tyrosyl-L-asparaginyl-L-α-glutamyl-L-tyrosyl-L-isoleucyl-L-tyrosyl-L-α-aspartyl-L-leucine |
| L-Leucine, L-isoleucyltyrosyl-L-asparaginyl-L-α-glutamyl-L-tyrosyl-L-isoleucyl-L-tyrosyl-L-α-aspartyl- |
| UNII-I0D08512Q1 |
| Trempamotide |
| 9592 |
