Introduction：Basic information about CAS 100761-17-9|Ganoderic acid M, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ganoderic acid M |
|---|
| CAS Number | 100761-17-9 | Molecular Weight | 530.650 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 722.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H42O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 404.6±29.4 °C |
|---|
Names
| Name | Ganoderic acid M |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 722.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H42O8 |
|---|
| Molecular Weight | 530.650 |
|---|
| Flash Point | 404.6±29.4 °C |
|---|
| Exact Mass | 530.287964 |
|---|
| LogP | 1.47 |
|---|
| Vapour Pressure | 0.0±5.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | LCIUOVOXWPIXOR-YUWDPXJWSA-N |
|---|
| SMILES | CC(CC(=O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)C(O)C12C)C1(C)CCC(=O)C(C)(C)C1CC3O)C(=O)O |
|---|
Synonyms
| Lanost-8-en-26-oic acid, 7,12-dihydroxy-3,11,15,23-tetraoxo-, (5ξ,7β,12β)- |
| (5ξ,7β,12β)-7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid |
| MFCD31560797 |
