Introduction:Basic information about CAS 1704065-90-6|ethyl 6-broMo-1,5-diMethyl-2-(2-nitroethyl)-1H-indole-3-carboxylate coMpound with M, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 6-broMo-1,5-diMethyl-2-(2-nitroethyl)-1H-indole-3-carboxylate coMpound with Methanedione (1:1) |
|---|
| CAS Number | 1704065-90-6 | Molecular Weight | 413.23 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H17BrN2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethyl 6-broMo-1,5-diMethyl-2-(2-nitroethyl)-1H-indole-3-carboxylate coMpound with Methanedione (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H17BrN2O6 |
|---|
| Molecular Weight | 413.23 |
|---|
| InChIKey | LWKUNWARFPQXFF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c(CC[N+](=O)[O-])n(C)c2cc(Br)c(OC(C)=O)cc12 |
|---|