Introduction：Basic information about CAS 24558-01-8|Levophacetoperane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Levophacetoperane |
|---|
| CAS Number | 24558-01-8 | Molecular Weight | 233.306 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 325.1±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.4±20.9 °C |
|---|
Names
| Name | Levophacetoperane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 325.1±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO2 |
|---|
| Molecular Weight | 233.306 |
|---|
| Flash Point | 150.4±20.9 °C |
|---|
| Exact Mass | 233.141586 |
|---|
| LogP | 2.51 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | BKPLVPRTTWIDNL-ZIAGYGMSSA-N |
|---|
| SMILES | CC(=O)OC(c1ccccc1)C1CCCCN1 |
|---|
Synonyms
| 1-Phenyl-1-(2'-piperidyl)-1-acetoxymethane |
| 2-Piperidinemethanol, α-phenyl-, acetate (ester) |
| Acetic Acid a-Phenyl-2-piperidylmethyl Ester |
| a-Phenyl-2-piperidinemethanol Acetate |
| Phacetoperane |
| Phenyl(2-piperidinyl)methyl acetate |
| Phenyl(piperidin-2-yl)methyl acetate |
| EINECS 245-536-8 |
