Introduction:Basic information about CAS 69029-39-6|Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether |
|---|
| CAS Number | 69029-39-6 | Molecular Weight | / |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H22O.(C3H6O)n.(C2H4O)x | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H22O.(C3H6O)n.(C2H4O)x |
|---|