Introduction:Basic information about CAS 1035631-57-2|9-phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
|---|
| CAS Number | 1035631-57-2 | Molecular Weight | 495.2252 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C30H35B2NO4 | Melting Point | 235.0 to 240.0 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 9-Phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
|---|
Chemical & Physical Properties
| Melting Point | 235.0 to 240.0 °C |
|---|
| Molecular Formula | C30H35B2NO4 |
|---|
| Molecular Weight | 495.2252 |
|---|
| InChIKey | BLKLIQJTGNDTOL-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OB(c2ccc3c4ccc(B5OC(C)(C)C(C)(C)O5)cc4n(-c4ccccc4)c3c2)OC1(C)C |
|---|