Introduction：Basic information about CAS 239807-03-5|Voriconazole Impurity 8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Voriconazole Impurity 8 |
|---|
| CAS Number | 239807-03-5 | Molecular Weight | 222.646 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 320.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H8ClFN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.5±26.5 °C |
|---|
Names
| Name | Voriconazole Impurity 8 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 320.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H8ClFN2 |
|---|
| Molecular Weight | 222.646 |
|---|
| Flash Point | 147.5±26.5 °C |
|---|
| Exact Mass | 222.036011 |
|---|
| LogP | 3.96 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | BCEHBSKCWLPMDN-HQNRFAHOSA-N |
|---|
| SMILES | CC(c1ncncc1F)C(O)(Cn1cncn1)c1ccc(F)cc1F |
|---|
Synonyms
| 6-Chloro-N-(4-fluorophenyl)-2-pyridinamine |
| MFCD13562822 |
| 2-Pyridinamine, 6-chloro-N-(4-fluorophenyl)- |
