Introduction：Basic information about CAS 324047-27-0|Isopropyl Ester of Cetirizine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Isopropyl Ester of Cetirizine |
|---|
| CAS Number | 324047-27-0 | Molecular Weight | 431.0 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H31ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Isopropyl Ester of Cetirizine |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H31ClN2O3 |
|---|
| Molecular Weight | 431.0 |
|---|
| InChIKey | XYBHROXLOFZZIR-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OC(=O)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
|---|
