Introduction:Basic information about CAS 893426-98-7|cis-N-((3-Azabicyclo[3.1.0]hexan-6-yl)methyl)-2-hydroxy-N-methyl-2,2-diphenylacetami, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cis-N-((3-Azabicyclo[3.1.0]hexan-6-yl)methyl)-2-hydroxy-N-methyl-2,2-diphenylacetamide hydrochloride |
|---|
| CAS Number | 893426-98-7 | Molecular Weight | 372.9 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C21H25ClN2O2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | cis-N-((3-Azabicyclo[3.1.0]hexan-6-yl)methyl)-2-hydroxy-N-methyl-2,2-diphenylacetamide hydrochloride |
|---|
Chemical & Physical Properties
| Molecular Formula | C21H25ClN2O2 |
|---|
| Molecular Weight | 372.9 |
|---|
| InChIKey | YHBAWCACDJQGDL-FMJRHHGGSA-N |
|---|
| SMILES | CN(CC1C2CNCC21)C(=O)C(O)(c1ccccc1)c1ccccc1.Cl |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|