Introduction:Basic information about CAS 72766-93-9|7-((Hydroxyacetyl)amino)actinomycin D ester with L-valine, monoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-((Hydroxyacetyl)amino)actinomycin D ester with L-valine, monoacetate |
|---|
| CAS Number | 72766-93-9 | Molecular Weight | 1487.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C71H102N14O21 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 7-((Hydroxyacetyl)amino)actinomycin D ester with L-valine, monoacetate |
|---|
Chemical & Physical Properties
| Molecular Formula | C71H102N14O21 |
|---|
| Molecular Weight | 1487.6 |
|---|
| InChIKey | AOCSMWMBUJQPHG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)O.Cc1c2oc3c(C)c(NC(=O)COC(=O)C(N)C(C)C)cc(C(=O)NC4C(=O)NC(C(C)C)C(=O)N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)c3nc-2c(C(=O)NC2C(=O)NC(C(C)C)C(=O)N3CCCC3C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC2C)c(N)c1=O |
|---|