Introduction：Basic information about CAS 763123-39-3|Hydrocortisone and lidocaine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hydrocortisone and lidocaine |
|---|
| CAS Number | 763123-39-3 | Molecular Weight | 596.8 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C35H52N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Hydrocortisone and lidocaine |
|---|
Chemical & Physical Properties
| Molecular Formula | C35H52N2O6 |
|---|
| Molecular Weight | 596.8 |
|---|
| InChIKey | YSNHIBGUFIJZMA-WDCKKOMHSA-N |
|---|
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO.CCN(CC)CC(=O)Nc1c(C)cccc1C |
|---|
