Introduction:Basic information about CAS 897394-70-6|Stereoisomer of 4-[[(1-phenylcyclopropyl)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Stereoisomer of 4-[[(1-phenylcyclopropyl)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1-carboxylic acid |
|---|
| CAS Number | 897394-70-6 | Molecular Weight | 339.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C21H25NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Stereoisomer of 4-[[(1-phenylcyclopropyl)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1-carboxylic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C21H25NO3 |
|---|
| Molecular Weight | 339.4 |
|---|
| InChIKey | RECLBMOYJXCZAG-UUDGIEBZSA-N |
|---|
| SMILES | O=C(O)C12CC3CC(C1)C(NC(=O)C1(c4ccccc4)CC1)C(C3)C2 |
|---|