Introduction：Basic information about CAS 239810-53-8|Diclofenac Sodium and Misoprostol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diclofenac Sodium and Misoprostol |
|---|
| CAS Number | 239810-53-8 | Molecular Weight | 700.7 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C36H48Cl2NNaO7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Diclofenac Sodium and Misoprostol |
|---|
Chemical & Physical Properties
| Molecular Formula | C36H48Cl2NNaO7 |
|---|
| Molecular Weight | 700.7 |
|---|
| InChIKey | HDEFOQFNRFJUCB-ZJJFNMROSA-M |
|---|
| SMILES | CCCCC(C)(O)CC=CC1C(O)CC(=O)C1CCCCCCC(=O)OC.O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+] |
|---|
